C11H8N2O3 — CID 168525503
7-(furan-2-yl)-4-methoxy-2,1,3-benzoxadiazole (PubChem CID 168525503) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 7-(furan-2-yl)-4-methoxy-2,1,3-benzoxadiazole.
| Compound Name | 7-(furan-2-yl)-4-methoxy-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 168525503 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 7-(furan-2-yl)-4-methoxy-2,1,3-benzoxadiazole |
| SMILES | COc1ccc(-c2ccco2)c2nonc12 |
| InChI | InChI=1S/C11H8N2O3/c1-14-9-5-4-7(8-3-2-6-15-8)10-11(9)13-16-12-10/h2-6H,1H3 |
| InChIKey | VBMDHTRVOXLLSE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |