C19H12F3NO3S — CID 168528228
3-[5-(furan-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]prop-2-enoic acid (PubChem CID 168528228) has the molecular formula C19H12F3NO3S and a molecular weight of 391.37 g/mol. Its IUPAC name is 3-[5-(furan-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-(furan-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 168528228 |
| Molecular Formula | C19H12F3NO3S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-[5-(furan-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(-c2ccco2)ccc1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H12F3NO3S/c20-19(21,22)14-5-7-17(23-11-14)27-16-6-3-12(15-2-1-9-26-15)10-13(16)4-8-18(24)25/h1-11H,(H,24,25) |
| InChIKey | NYVOMRSPZBEQHA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|