C9H11BrN2O2 — CID 168529699
(6-bromo-2,3-dimethoxyphenyl)methylidenehydrazine (PubChem CID 168529699) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is (6-bromo-2,3-dimethoxyphenyl)methylidenehydrazine.
| Compound Name | (6-bromo-2,3-dimethoxyphenyl)methylidenehydrazine |
|---|---|
| PubChem CID | 168529699 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (6-bromo-2,3-dimethoxyphenyl)methylidenehydrazine |
| SMILES | COc1ccc(Br)c(C=NN)c1OC |
| InChI | InChI=1S/C9H11BrN2O2/c1-13-8-4-3-7(10)6(5-12-11)9(8)14-2/h3-5H,11H2,1-2H3 |
| InChIKey | LLDSBVHDXFPGRD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|