C14H13N5O5 — CID 168533154
[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]urea (PubChem CID 168533154) has the molecular formula C14H13N5O5 and a molecular weight of 331.29 g/mol. Its IUPAC name is [[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]urea.
| Compound Name | [[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533154 |
| Molecular Formula | C14H13N5O5 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]urea |
| SMILES | COc1cc(C=NNC(N)=O)ccc1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N5O5/c1-23-12-7-9(8-17-18-14(15)20)4-5-11(12)24-13-10(19(21)22)3-2-6-16-13/h2-8H,1H3,(H3,15,18,20) |
| InChIKey | WXJBFHKNFOWKMW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|