C14H20BN3O4 — CID 168533547
[[4-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]urea (PubChem CID 168533547) has the molecular formula C14H20BN3O4 and a molecular weight of 305.14 g/mol. Its IUPAC name is [[4-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]urea.
| Compound Name | [[4-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533547 |
| Molecular Formula | C14H20BN3O4 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | [[4-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]urea |
| SMILES | CC1(C)OB(c2cc(C=NNC(N)=O)ccc2O)OC1(C)C |
| InChI | InChI=1S/C14H20BN3O4/c1-13(2)14(3,4)22-15(21-13)10-7-9(5-6-11(10)19)8-17-18-12(16)20/h5-8,19H,1-4H3,(H3,16,18,20) |
| InChIKey | RTRRBJPXSDSQRX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|