C20H24N4O3S — CID 168535689
2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 168535689) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 168535689 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxyphenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | CCOc1cc(C=NNC(N)=S)ccc1OCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H24N4O3S/c1-2-26-18-12-16(13-23-24-20(21)28)8-9-17(18)27-14-19(25)22-11-10-15-6-4-3-5-7-15/h3-9,12-13H,2,10-11,14H2,1H3,(H,22,25)(H3,21,24,28) |
| InChIKey | IOKRGSIFBBWBLA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|