C12H13Br2N3O2S — CID 168535716
[(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]thiourea (PubChem CID 168535716) has the molecular formula C12H13Br2N3O2S and a molecular weight of 423.13 g/mol. Its IUPAC name is [(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]thiourea.
| Compound Name | [(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535716 |
| Molecular Formula | C12H13Br2N3O2S |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | [(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]thiourea |
| SMILES | C=CCOc1c(OC)cc(C=NNC(N)=S)c(Br)c1Br |
| InChI | InChI=1S/C12H13Br2N3O2S/c1-3-4-19-11-8(18-2)5-7(9(13)10(11)14)6-16-17-12(15)20/h3,5-6H,1,4H2,2H3,(H3,15,17,20) |
| InChIKey | HBAWFEBIGPSEJE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|