C18H21FN2O6 — CID 168537909
tert-butyl N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-fluorophenyl]carbamate (PubChem CID 168537909) has the molecular formula C18H21FN2O6 and a molecular weight of 380.37 g/mol. Its IUPAC name is tert-butyl N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 168537909 |
| Molecular Formula | C18H21FN2O6 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | tert-butyl N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC=C2C(=O)OC(C)(C)OC2=O)cc1F |
| InChI | InChI=1S/C18H21FN2O6/c1-17(2,3)27-16(24)21-13-7-6-10(8-12(13)19)20-9-11-14(22)25-18(4,5)26-15(11)23/h6-9,20H,1-5H3,(H,21,24) |
| InChIKey | IZGAFVSVANAUHS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|