C18H15N7 — CID 168543047
2-[[4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]anilino]methylidene]propanedinitrile (PubChem CID 168543047) has the molecular formula C18H15N7 and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[[4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543047 |
| Molecular Formula | C18H15N7 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[[4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]anilino]methylidene]propanedinitrile |
| SMILES | Cc1nn(C)cc1-c1ccn(-c2ccc(NC=C(C#N)C#N)cc2)n1 |
| InChI | InChI=1S/C18H15N7/c1-13-17(12-24(2)22-13)18-7-8-25(23-18)16-5-3-15(4-6-16)21-11-14(9-19)10-20/h3-8,11-12,21H,1-2H3 |
| InChIKey | UOLPIENABFLDSU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|