About 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile
2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile (PubChem CID 168542758) has the molecular formula C13H10N6
and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile |
| PubChem CID | 168542758 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile |
| SMILES | Cc1nc(-c2ccc(NC=C(C#N)C#N)cc2)n[nH]1 |
| InChI | InChI=1S/C13H10N6/c1-9-17-13(19-18-9)11-2-4-12(5-3-11)16-8-10(6-14)7-15/h2-5,8,16H,1H3,(H,17,18,19) |
| InChIKey | AAIDHTFIJNCRKI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile?
The IUPAC name of 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile (CID 168542758) is 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile.
What is the SMILES notation for 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile?
The canonical SMILES for 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile is Cc1nc(-c2ccc(NC=C(C#N)C#N)cc2)n[nH]1.
What is the InChIKey of 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile?
The InChIKey is AAIDHTFIJNCRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N6/c1-9-17-13(19-18-9)11-2-4-12(5-3-11)16-8-10(6-14)7-15/h2-5,8,16H,1H3,(H,17,18,19).
What are the key properties of 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile?
2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile has a molecular weight of 250.27 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(5-methyl-1H-1,2,4-triazol-3-yl)anilino]methylidene]propanedinitrile is sourced from PubChem (CID 168542758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).