C14H12N6 — CID 168542036
2-[[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]anilino]methylidene]propanedinitrile (PubChem CID 168542036) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-[[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542036 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[[4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]anilino]methylidene]propanedinitrile |
| SMILES | Cc1nc(Cc2ccc(NC=C(C#N)C#N)cc2)n[nH]1 |
| InChI | InChI=1S/C14H12N6/c1-10-18-14(20-19-10)6-11-2-4-13(5-3-11)17-9-12(7-15)8-16/h2-5,9,17H,6H2,1H3,(H,18,19,20) |
| InChIKey | RIIRFIMTSYJANY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|