C12H17N3 — CID 143974565
ethane;5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole (PubChem CID 143974565) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is ethane;5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole.
| Compound Name | ethane;5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 143974565 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | ethane;5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole |
| SMILES | CC.Cc1ccc(-c2n[nH]c(C)n2)cc1 |
| InChI | InChI=1S/C10H11N3.C2H6/c1-7-3-5-9(6-4-7)10-11-8(2)12-13-10;1-2/h3-6H,1-2H3,(H,11,12,13);1-2H3 |
| InChIKey | CDSFYZFPCRVANC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |