C16H11N9O — CID 169346021
3-[4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346021) has the molecular formula C16H11N9O and a molecular weight of 345.33 g/mol. Its IUPAC name is 3-[4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346021 |
| Molecular Formula | C16H11N9O |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-[4-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(-c2n[nH]c(-c3ccco3)n2)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C16H11N9O/c17-8-11(15-22-24-25-23-15)9-18-12-5-3-10(4-6-12)14-19-16(21-20-14)13-2-1-7-26-13/h1-7,9,18H,(H,19,20,21)(H,22,23,24,25) |
| InChIKey | SBRWWCZQVFIQQV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|