C13H9N5O — CID 168542305
2-[[4-(5-oxo-1,4-dihydropyrazol-3-yl)anilino]methylidene]propanedinitrile (PubChem CID 168542305) has the molecular formula C13H9N5O and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-[[4-(5-oxo-1,4-dihydropyrazol-3-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(5-oxo-1,4-dihydropyrazol-3-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542305 |
| Molecular Formula | C13H9N5O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[[4-(5-oxo-1,4-dihydropyrazol-3-yl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(C2=NNC(=O)C2)cc1 |
| InChI | InChI=1S/C13H9N5O/c14-6-9(7-15)8-16-11-3-1-10(2-4-11)12-5-13(19)18-17-12/h1-4,8,16H,5H2,(H,18,19) |
| InChIKey | XMJMXKUZRYWKEC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|