C17H16N6O — CID 168544078
1-[4-(2,2-dicyanoethenylamino)phenyl]-N-propan-2-ylpyrazole-3-carboxamide (PubChem CID 168544078) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-[4-(2,2-dicyanoethenylamino)phenyl]-N-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-[4-(2,2-dicyanoethenylamino)phenyl]-N-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 168544078 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[4-(2,2-dicyanoethenylamino)phenyl]-N-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)NC(=O)c1ccn(-c2ccc(NC=C(C#N)C#N)cc2)n1 |
| InChI | InChI=1S/C17H16N6O/c1-12(2)21-17(24)16-7-8-23(22-16)15-5-3-14(4-6-15)20-11-13(9-18)10-19/h3-8,11-12,20H,1-2H3,(H,21,24) |
| InChIKey | YOTVNUWXFXTYQG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|