C17H17BN4O2 — CID 168543100
2-[[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methylidene]propanedinitrile (PubChem CID 168543100) has the molecular formula C17H17BN4O2 and a molecular weight of 320.16 g/mol. Its IUPAC name is 2-[[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543100 |
| Molecular Formula | C17H17BN4O2 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]methylidene]propanedinitrile |
| SMILES | CC1(C)OB(c2cc(C#N)cc(NC=C(C#N)C#N)c2)OC1(C)C |
| InChI | InChI=1S/C17H17BN4O2/c1-16(2)17(3,4)24-18(23-16)14-5-12(8-19)6-15(7-14)22-11-13(9-20)10-21/h5-7,11,22H,1-4H3 |
| InChIKey | DNHQSEKUYLASLL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|