C22H21BN2O2 — CID 168550648
2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]methylidene]propanedinitrile (PubChem CID 168550648) has the molecular formula C22H21BN2O2 and a molecular weight of 356.23 g/mol. Its IUPAC name is 2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168550648 |
| Molecular Formula | C22H21BN2O2 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]methylidene]propanedinitrile |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(C=C(C#N)C#N)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H21BN2O2/c1-21(2)22(3,4)27-23(26-21)20-11-9-19(10-12-20)18-7-5-16(6-8-18)13-17(14-24)15-25/h5-13H,1-4H3 |
| InChIKey | LEBYCKQHFKQAEH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|