C15H21BN6O2 — CID 168603475
2-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168603475) has the molecular formula C15H21BN6O2 and a molecular weight of 328.19 g/mol. Its IUPAC name is 2-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168603475 |
| Molecular Formula | C15H21BN6O2 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CC1(C)OB(c2cc(C#N)cc(/N=C(\N)N=C(N)N)c2)OC1(C)C |
| InChI | InChI=1S/C15H21BN6O2/c1-14(2)15(3,4)24-16(23-14)10-5-9(8-17)6-11(7-10)21-13(20)22-12(18)19/h5-7H,1-4H3,(H6,18,19,20,21,22) |
| InChIKey | KRTUFMIKWKEKJE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|