C17H11F2N5O — CID 168544827
1-[4-(2,2-dicyanoethenylamino)-3-fluorophenyl]-3-(4-fluorophenyl)urea (PubChem CID 168544827) has the molecular formula C17H11F2N5O and a molecular weight of 339.31 g/mol. Its IUPAC name is 1-[4-(2,2-dicyanoethenylamino)-3-fluorophenyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-(2,2-dicyanoethenylamino)-3-fluorophenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 168544827 |
| Molecular Formula | C17H11F2N5O |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-[4-(2,2-dicyanoethenylamino)-3-fluorophenyl]-3-(4-fluorophenyl)urea |
| SMILES | N#CC(C#N)=CNc1ccc(NC(=O)Nc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C17H11F2N5O/c18-12-1-3-13(4-2-12)23-17(25)24-14-5-6-16(15(19)7-14)22-10-11(8-20)9-21/h1-7,10,22H,(H2,23,24,25) |
| InChIKey | LNGLTRASBLRRIA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|