C16H15BrN4O5 — CID 168546178
methyl 3-amino-1-(4-bromo-2-nitro-5-propoxyphenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168546178) has the molecular formula C16H15BrN4O5 and a molecular weight of 423.22 g/mol. Its IUPAC name is methyl 3-amino-1-(4-bromo-2-nitro-5-propoxyphenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(4-bromo-2-nitro-5-propoxyphenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546178 |
| Molecular Formula | C16H15BrN4O5 |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | methyl 3-amino-1-(4-bromo-2-nitro-5-propoxyphenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | CCCOc1cc(-n2cc(C#N)c(N)c2C(=O)OC)c([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C16H15BrN4O5/c1-3-4-26-13-6-11(12(21(23)24)5-10(13)17)20-8-9(7-18)14(19)15(20)16(22)25-2/h5-6,8H,3-4,19H2,1-2H3 |
| InChIKey | SCGJJGIJWMIGEN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|