C19H21N5O5 — CID 168548949
methyl 3-amino-4-cyano-1-[2-[(ethoxycarbonylamino)carbamoyl]-3,5-dimethylphenyl]pyrrole-2-carboxylate (PubChem CID 168548949) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[2-[(ethoxycarbonylamino)carbamoyl]-3,5-dimethylphenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[2-[(ethoxycarbonylamino)carbamoyl]-3,5-dimethylphenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548949 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[2-[(ethoxycarbonylamino)carbamoyl]-3,5-dimethylphenyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)NNC(=O)c1c(C)cc(C)cc1-n1cc(C#N)c(N)c1C(=O)OC |
| InChI | InChI=1S/C19H21N5O5/c1-5-29-19(27)23-22-17(25)14-11(3)6-10(2)7-13(14)24-9-12(8-20)15(21)16(24)18(26)28-4/h6-7,9H,5,21H2,1-4H3,(H,22,25)(H,23,27) |
| InChIKey | IWKBZKAIYHAMBO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 148.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|