C19H25N3O6Si — CID 168549536
methyl 3-amino-4-cyano-1-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrole-2-carboxylate (PubChem CID 168549536) has the molecular formula C19H25N3O6Si and a molecular weight of 419.51 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549536 |
| Molecular Formula | C19H25N3O6Si |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-(3-trimethoxysilylpropoxy)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc(OCCC[Si](OC)(OC)OC)c1 |
| InChI | InChI=1S/C19H25N3O6Si/c1-24-19(23)18-17(21)14(12-20)13-22(18)15-7-5-8-16(11-15)28-9-6-10-29(25-2,26-3)27-4/h5,7-8,11,13H,6,9-10,21H2,1-4H3 |
| InChIKey | RGKGHMBJCQMSIU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|