C13H8N6O5 — CID 168549780
methyl 3-amino-4-cyano-1-(5-nitro-2,1,3-benzoxadiazol-4-yl)pyrrole-2-carboxylate (PubChem CID 168549780) has the molecular formula C13H8N6O5 and a molecular weight of 328.24 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(5-nitro-2,1,3-benzoxadiazol-4-yl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(5-nitro-2,1,3-benzoxadiazol-4-yl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549780 |
| Molecular Formula | C13H8N6O5 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(5-nitro-2,1,3-benzoxadiazol-4-yl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c([N+](=O)[O-])ccc2nonc12 |
| InChI | InChI=1S/C13H8N6O5/c1-23-13(20)12-9(15)6(4-14)5-18(12)11-8(19(21)22)3-2-7-10(11)17-24-16-7/h2-3,5H,15H2,1H3 |
| InChIKey | JSMAMMMJXCBBFW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 163.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|