C18H15ClN2O3S — CID 168551720
methyl 3-[3-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl]sulfanylpropanoate (PubChem CID 168551720) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is methyl 3-[3-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl]sulfanylpropanoate.
| Compound Name | methyl 3-[3-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 168551720 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | methyl 3-[3-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSc1cccc(Cl)c1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-24-15(22)9-10-25-14-8-4-6-12(19)16(14)17-20-13-7-3-2-5-11(13)18(23)21-17/h2-8H,9-10H2,1H3,(H,20,21,23) |
| InChIKey | POHIOBKQQFTIIE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |