C18H24N2O4S — CID 168562782
methyl 4-(4-butylsulfanylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562782) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is methyl 4-(4-butylsulfanylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(4-butylsulfanylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562782 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 4-(4-butylsulfanylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCCCSc1ccc(NC2=C(C(=O)OC)CN(CCO)C2=O)cc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-3-4-11-25-14-7-5-13(6-8-14)19-16-15(18(23)24-2)12-20(9-10-21)17(16)22/h5-8,19,21H,3-4,9-12H2,1-2H3 |
| InChIKey | QVWHGJOZMWTREP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|