C18H23FN2O6 — CID 168563719
methyl 4-[3-fluoro-4-(3-methoxypropoxy)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168563719) has the molecular formula C18H23FN2O6 and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl 4-[3-fluoro-4-(3-methoxypropoxy)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[3-fluoro-4-(3-methoxypropoxy)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563719 |
| Molecular Formula | C18H23FN2O6 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 4-[3-fluoro-4-(3-methoxypropoxy)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COCCCOc1ccc(NC2=C(C(=O)OC)CN(CCO)C2=O)cc1F |
| InChI | InChI=1S/C18H23FN2O6/c1-25-8-3-9-27-15-5-4-12(10-14(15)19)20-16-13(18(24)26-2)11-21(6-7-22)17(16)23/h4-5,10,20,22H,3,6-9,11H2,1-2H3 |
| InChIKey | ZZDILFQUGOAZSQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|