C17H23N3O5 — CID 168570113
dimethyl (E)-2-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]but-2-enedioate (PubChem CID 168570113) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570113 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | dimethyl (E)-2-[2-[[2-(dimethylamino)acetyl]amino]-5-methylanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C)ccc1NC(=O)CN(C)C)C(=O)OC |
| InChI | InChI=1S/C17H23N3O5/c1-11-6-7-12(19-15(21)10-20(2)3)13(8-11)18-14(17(23)25-5)9-16(22)24-4/h6-9,18H,10H2,1-5H3,(H,19,21)/b14-9+ |
| InChIKey | HKQLMJAODMXHCE-NTEUORMPSA-N |
| XLogP | 1.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|