C25H21BrN4O2S — CID 168578353
N-benzyl-2-[4-bromo-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 168578353) has the molecular formula C25H21BrN4O2S and a molecular weight of 521.44 g/mol. Its IUPAC name is N-benzyl-2-[4-bromo-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-benzyl-2-[4-bromo-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 168578353 |
| Molecular Formula | C25H21BrN4O2S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | N-benzyl-2-[4-bromo-2-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1C=NNc1nc(-c2ccccc2)cs1)NCc1ccccc1 |
| InChI | InChI=1S/C25H21BrN4O2S/c26-21-11-12-23(32-16-24(31)27-14-18-7-3-1-4-8-18)20(13-21)15-28-30-25-29-22(17-33-25)19-9-5-2-6-10-19/h1-13,15,17H,14,16H2,(H,27,31)(H,29,30) |
| InChIKey | YNPBGPCLSRYSML-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|