C20H24ClN3O2S2 — CID 168581558
N-(1-adamantyl)-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzenesulfonamide (PubChem CID 168581558) has the molecular formula C20H24ClN3O2S2 and a molecular weight of 438.02 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzenesulfonamide.
| Compound Name | N-(1-adamantyl)-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 168581558 |
| Molecular Formula | C20H24ClN3O2S2 |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(1-adamantyl)-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzenesulfonamide |
| SMILES | O=S(=O)(NC12CC3CC(CC(C3)C1)C2)c1ccc(NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C20H24ClN3O2S2/c21-19-23-12-17(27-19)11-22-16-1-3-18(4-2-16)28(25,26)24-20-8-13-5-14(9-20)7-15(6-13)10-20/h1-4,12-15,22,24H,5-11H2 |
| InChIKey | LNQWNTYGZLGIBP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |