C22H25ClN2O2S — CID 168581447
1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate (PubChem CID 168581447) has the molecular formula C22H25ClN2O2S and a molecular weight of 416.97 g/mol. Its IUPAC name is 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate.
| Compound Name | 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 168581447 |
| Molecular Formula | C22H25ClN2O2S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)c1ccc(NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C22H25ClN2O2S/c23-21-25-12-19(28-21)11-24-18-3-1-17(2-4-18)20(26)27-13-22-8-14-5-15(9-22)7-16(6-14)10-22/h1-4,12,14-16,24H,5-11,13H2 |
| InChIKey | GLAUOJWBSXWWCJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |