About 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate
1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate (PubChem CID 168581447) has the molecular formula C22H25ClN2O2S
and a molecular weight of 416.97 g/mol. Its IUPAC name is 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate |
| PubChem CID | 168581447 |
| Molecular Formula | C22H25ClN2O2S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)c1ccc(NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C22H25ClN2O2S/c23-21-25-12-19(28-21)11-24-18-3-1-17(2-4-18)20(26)27-13-22-8-14-5-15(9-22)7-16(6-14)10-22/h1-4,12,14-16,24H,5-11,13H2 |
| InChIKey | GLAUOJWBSXWWCJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate?
The IUPAC name of 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate (CID 168581447) is 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate.
What is the SMILES notation for 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate?
The canonical SMILES for 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate is O=C(OCC12CC3CC(CC(C3)C1)C2)c1ccc(NCc2cnc(Cl)s2)cc1.
What is the InChIKey of 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate?
The InChIKey is GLAUOJWBSXWWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClN2O2S/c23-21-25-12-19(28-21)11-24-18-3-1-17(2-4-18)20(26)27-13-22-8-14-5-15(9-22)7-16(6-14)10-22/h1-4,12,14-16,24H,5-11,13H2.
What are the key properties of 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate?
1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate has a molecular weight of 416.97 g/mol, XLogP of 5.78, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate is sourced from PubChem (CID 168581447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).