C21H11F6N3O6S — CID 168585467
[2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-4-nitrophenyl] 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 168585467) has the molecular formula C21H11F6N3O6S and a molecular weight of 547.39 g/mol. Its IUPAC name is [2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-4-nitrophenyl] 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-4-nitrophenyl] 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 168585467 |
| Molecular Formula | C21H11F6N3O6S |
| Molecular Weight | 547.39 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | [2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-4-nitrophenyl] 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1cc(-c2cc([N+](=O)[O-])ccc2OS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C21H11F6N3O6S/c1-10-4-15(17(9-28)19(31)29-10)16-8-13(30(32)33)2-3-18(16)36-37(34,35)14-6-11(20(22,23)24)5-12(7-14)21(25,26)27/h2-8H,1H3,(H,29,31) |
| InChIKey | VOEBTGVZXVZDCS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|