C17H15N3O6 — CID 168586218
[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxy-3-nitrophenyl] acetate (PubChem CID 168586218) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxy-3-nitrophenyl] acetate.
| Compound Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxy-3-nitrophenyl] acetate |
|---|---|
| PubChem CID | 168586218 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxy-3-nitrophenyl] acetate |
| SMILES | CCOc1c(OC(C)=O)ccc(-c2cc(C)[nH]c(=O)c2C#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O6/c1-4-25-16-14(26-10(3)21)6-5-11(15(16)20(23)24)12-7-9(2)19-17(22)13(12)8-18/h5-7H,4H2,1-3H3,(H,19,22) |
| InChIKey | MOUARRVXHWIHHA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|