C14H10N4O2S — CID 168588788
2-methylsulfanyl-6-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrimidine-5-carbonitrile (PubChem CID 168588788) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-methylsulfanyl-6-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-6-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588788 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-methylsulfanyl-6-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc3c(c2)CC(=O)N3)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C14H10N4O2S/c1-21-14-17-12(9(6-15)13(20)18-14)7-2-3-10-8(4-7)5-11(19)16-10/h2-4H,5H2,1H3,(H,16,19)(H,17,18,20) |
| InChIKey | IWYSPRZEXCNFEH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|