C16H12N6O4S — CID 168589210
2-methylsulfanyl-4-[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589210) has the molecular formula C16H12N6O4S and a molecular weight of 384.38 g/mol. Its IUPAC name is 2-methylsulfanyl-4-[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-4-[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589210 |
| Molecular Formula | C16H12N6O4S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-methylsulfanyl-4-[4-[(3-nitropyrazol-1-yl)methoxy]phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(OCn3ccc([N+](=O)[O-])n3)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C16H12N6O4S/c1-27-16-18-14(12(8-17)15(23)19-16)10-2-4-11(5-3-10)26-9-21-7-6-13(20-21)22(24)25/h2-7H,9H2,1H3,(H,18,19,23) |
| InChIKey | ICCQQROSHBUDLU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|