C12H16N2O6S — CID 168594970
methyl 2-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]sulfanylacetate (PubChem CID 168594970) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is methyl 2-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]sulfanylacetate.
| Compound Name | methyl 2-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 168594970 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 2-[4-(2,3-dihydroxypropylamino)-2-nitrophenyl]sulfanylacetate |
| SMILES | COC(=O)CSc1ccc(NCC(O)CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O6S/c1-20-12(17)7-21-11-3-2-8(4-10(11)14(18)19)13-5-9(16)6-15/h2-4,9,13,15-16H,5-7H2,1H3 |
| InChIKey | CJGDUSOVTOOGOB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|