C18H18ClNO5 — CID 168595543
(2-chlorophenyl)-[6-(2,3-dihydroxypropylamino)-2,3-dihydro-1,4-benzodioxin-7-yl]methanone (PubChem CID 168595543) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is (2-chlorophenyl)-[6-(2,3-dihydroxypropylamino)-2,3-dihydro-1,4-benzodioxin-7-yl]methanone.
| Compound Name | (2-chlorophenyl)-[6-(2,3-dihydroxypropylamino)-2,3-dihydro-1,4-benzodioxin-7-yl]methanone |
|---|---|
| PubChem CID | 168595543 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (2-chlorophenyl)-[6-(2,3-dihydroxypropylamino)-2,3-dihydro-1,4-benzodioxin-7-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)c1cc2c(cc1NCC(O)CO)OCCO2 |
| InChI | InChI=1S/C18H18ClNO5/c19-14-4-2-1-3-12(14)18(23)13-7-16-17(25-6-5-24-16)8-15(13)20-9-11(22)10-21/h1-4,7-8,11,20-22H,5-6,9-10H2 |
| InChIKey | SIRPWNURBQQXNR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|