C21H29N5O2 — CID 168595625
3-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]amino]propane-1,2-diol (PubChem CID 168595625) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168595625 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 3-[[2-[4-(diethylamino)-2-methylphenyl]-6-methylbenzotriazol-5-yl]amino]propane-1,2-diol |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NCC(O)CO)cc3n2)c(C)c1 |
| InChI | InChI=1S/C21H29N5O2/c1-5-25(6-2)16-7-8-21(15(4)9-16)26-23-19-10-14(3)18(11-20(19)24-26)22-12-17(28)13-27/h7-11,17,22,27-28H,5-6,12-13H2,1-4H3 |
| InChIKey | UNKICNFJXIPYGI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|