C21H27NO6 — CID 168599785
5-[[4-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599785) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 5-[[4-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[4-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599785 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 5-[[4-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1CN(CCOc2ccc(C=C3C(=O)OC(C)(C)OC3=O)cc2)CC(C)O1 |
| InChI | InChI=1S/C21H27NO6/c1-14-12-22(13-15(2)26-14)9-10-25-17-7-5-16(6-8-17)11-18-19(23)27-21(3,4)28-20(18)24/h5-8,11,14-15H,9-10,12-13H2,1-4H3 |
| InChIKey | GRPGNODYXSTNII-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|