C14H14ClN5 — CID 168602563
2-[4-(3-chlorophenyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168602563) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[4-(3-chlorophenyl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168602563 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[4-(3-chlorophenyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C14H14ClN5/c15-11-3-1-2-10(8-11)9-4-6-12(7-5-9)19-14(18)20-13(16)17/h1-8H,(H6,16,17,18,19,20) |
| InChIKey | USNUYJDFOXTGCX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|