C15H15N5O2 — CID 168604342
2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]benzoic acid (PubChem CID 168604342) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]benzoic acid.
| Compound Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 168604342 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]benzoic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H15N5O2/c16-14(17)20-15(18)19-10-7-5-9(6-8-10)11-3-1-2-4-12(11)13(21)22/h1-8H,(H,21,22)(H6,16,17,18,19,20) |
| InChIKey | QDZRHJDKZOUHTN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|