C14H21ClN6 — CID 168602614
2-[3-chloro-2-(3-methylpiperidin-1-yl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168602614) has the molecular formula C14H21ClN6 and a molecular weight of 308.82 g/mol. Its IUPAC name is 2-[3-chloro-2-(3-methylpiperidin-1-yl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-chloro-2-(3-methylpiperidin-1-yl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168602614 |
| Molecular Formula | C14H21ClN6 |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[3-chloro-2-(3-methylpiperidin-1-yl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CC1CCCN(c2c(Cl)cccc2/N=C(\N)N=C(N)N)C1 |
| InChI | InChI=1S/C14H21ClN6/c1-9-4-3-7-21(8-9)12-10(15)5-2-6-11(12)19-14(18)20-13(16)17/h2,5-6,9H,3-4,7-8H2,1H3,(H6,16,17,18,19,20) |
| InChIKey | XTKPPKAPZJIHCS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|