C16H10N4OS — CID 168606758
2-[3-[hydroxy(thiophen-2-yl)methyl]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168606758) has the molecular formula C16H10N4OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[3-[hydroxy(thiophen-2-yl)methyl]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-[hydroxy(thiophen-2-yl)methyl]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606758 |
| Molecular Formula | C16H10N4OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-[3-[hydroxy(thiophen-2-yl)methyl]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc(C(O)c2cccs2)c1 |
| InChI | InChI=1S/C16H10N4OS/c17-8-12(9-18)14(10-19)20-13-4-1-3-11(7-13)16(21)15-5-2-6-22-15/h1-7,16,20-21H |
| InChIKey | KKFNWWUSVOSHPR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|