C13H6BrF3N4O — CID 168607528
2-[3-bromo-4-methoxy-5-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607528) has the molecular formula C13H6BrF3N4O and a molecular weight of 371.12 g/mol. Its IUPAC name is 2-[3-bromo-4-methoxy-5-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-bromo-4-methoxy-5-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607528 |
| Molecular Formula | C13H6BrF3N4O |
| Molecular Weight | 371.12 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2-[3-bromo-4-methoxy-5-(trifluoromethyl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | COc1c(Br)cc(NC(C#N)=C(C#N)C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H6BrF3N4O/c1-22-12-9(13(15,16)17)2-8(3-10(12)14)21-11(6-20)7(4-18)5-19/h2-3,21H,1H3 |
| InChIKey | OKEOGQBSEIKGIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.12 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|