C19H18N6 — CID 168610061
2-[(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168610061) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-[(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610061 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC1(C)CC(C)(C)c2c1cc1[nH]ncc1c2NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C19H18N6/c1-18(2)10-19(3,4)16-13(18)5-14-12(9-23-25-14)17(16)24-15(8-22)11(6-20)7-21/h5,9,24H,10H2,1-4H3,(H,23,25) |
| InChIKey | SNYJQPDEMHKFEV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|