C13H11FN4 — CID 168630860
1-[(2-ethynyl-6-fluorophenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168630860) has the molecular formula C13H11FN4 and a molecular weight of 242.26 g/mol. Its IUPAC name is 1-[(2-ethynyl-6-fluorophenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(2-ethynyl-6-fluorophenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168630860 |
| Molecular Formula | C13H11FN4 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-[(2-ethynyl-6-fluorophenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | C#Cc1cccc(F)c1C=Nn1cc(C)nc1N |
| InChI | InChI=1S/C13H11FN4/c1-3-10-5-4-6-12(14)11(10)7-16-18-8-9(2)17-13(18)15/h1,4-8H,2H3,(H2,15,17) |
| InChIKey | ZVLSGNNBHOSORQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|