C11H9ClF5NO3 — CID 168639964
1-chloro-3-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)amino]propan-2-ol (PubChem CID 168639964) has the molecular formula C11H9ClF5NO3 and a molecular weight of 333.64 g/mol. Its IUPAC name is 1-chloro-3-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 168639964 |
| Molecular Formula | C11H9ClF5NO3 |
| Molecular Weight | 333.64 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-chloro-3-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)amino]propan-2-ol |
| SMILES | OC(CCl)CNc1cc2c(cc1F)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C11H9ClF5NO3/c12-3-5(19)4-18-7-2-9-8(1-6(7)13)20-10(14,15)11(16,17)21-9/h1-2,5,18-19H,3-4H2 |
| InChIKey | GNIKAOGEWGSAKH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|