C14H18ClNO3 — CID 168641010
1-chloro-3-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)propan-2-ol (PubChem CID 168641010) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 1-chloro-3-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)propan-2-ol.
| Compound Name | 1-chloro-3-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 168641010 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-chloro-3-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)propan-2-ol |
| SMILES | OC(CCl)CNc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C14H18ClNO3/c15-8-11(17)9-16-10-3-4-12-13(7-10)19-14(18-12)5-1-2-6-14/h3-4,7,11,16-17H,1-2,5-6,8-9H2 |
| InChIKey | BZLRFGQLDOSNPR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|