C30H28N6O4 — CID 168643092
dimethyl 6-amino-5-cyano-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168643092) has the molecular formula C30H28N6O4 and a molecular weight of 536.59 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168643092 |
| Molecular Formula | C30H28N6O4 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C30H28N6O4/c1-35(2)22-14-10-20(11-15-22)33-34-21-12-16-23(17-13-21)36-27(30(38)40-4)26(29(37)39-3)25(24(18-31)28(36)32)19-8-6-5-7-9-19/h5-17,25H,32H2,1-4H3/b34-33+ |
| InChIKey | NDDCARGCAPIZTO-JEIPZWNWSA-N |
| XLogP | 5.07 |
| TPSA | 133.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|