C29H21ClF2N4O5 — CID 168644127
dimethyl 6-amino-1-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168644127) has the molecular formula C29H21ClF2N4O5 and a molecular weight of 578.96 g/mol. Its IUPAC name is dimethyl 6-amino-1-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-1-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168644127 |
| Molecular Formula | C29H21ClF2N4O5 |
| Molecular Weight | 578.96 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | dimethyl 6-amino-1-[4-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-5-cyano-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(NC(=O)c3cc(F)c(F)cc3Cl)cc2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C29H21ClF2N4O5/c1-40-28(38)24-23(15-6-4-3-5-7-15)19(14-33)26(34)36(25(24)29(39)41-2)17-10-8-16(9-11-17)35-27(37)18-12-21(31)22(32)13-20(18)30/h3-13,23H,34H2,1-2H3,(H,35,37) |
| InChIKey | DZQCLZUWYVUOSH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.96 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|