C16H13BrINO5 — CID 168647091
dimethyl 1-(6-bromo-2-hydroxy-3-iodophenyl)azepine-2,3-dicarboxylate (PubChem CID 168647091) has the molecular formula C16H13BrINO5 and a molecular weight of 506.09 g/mol. Its IUPAC name is dimethyl 1-(6-bromo-2-hydroxy-3-iodophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(6-bromo-2-hydroxy-3-iodophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647091 |
| Molecular Formula | C16H13BrINO5 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 504.90 |
| IUPAC Name | dimethyl 1-(6-bromo-2-hydroxy-3-iodophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Br)ccc(I)c2O)C=CC=C1 |
| InChI | InChI=1S/C16H13BrINO5/c1-23-15(21)9-5-3-4-8-19(12(9)16(22)24-2)13-10(17)6-7-11(18)14(13)20/h3-8,20H,1-2H3 |
| InChIKey | HQRSJPHCXKGZNE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|